2-[(Piperidin-4-ylmethyl)-amino]-nicotinicacidmethylestertrifluoro-aceticacid structure
|
Common Name | 2-[(Piperidin-4-ylmethyl)-amino]-nicotinicacidmethylestertrifluoro-aceticacid | ||
|---|---|---|---|---|
| CAS Number | 1185317-13-8 | Molecular Weight | 363.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(piperidin-4-ylmethylamino)pyridine-3-carboxylate,2,2,2-trifluoroacetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20F3N3O4 |
|---|---|
| Molecular Weight | 363.33200 |
| Exact Mass | 363.14100 |
| PSA | 100.55000 |
| LogP | 2.31480 |
| InChIKey | FQDYSKMZJNNPKL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccnc1NCC1CCNCC1.O=C(O)C(F)(F)F |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-[(4-piperidylmethyl)amino]pyridine-3-carboxylate,2,2,2-trifluoroacet ic acid |
| 2-[(Piperidin-4-ylmethyl)-amino]-nicotinic acid methyl ester trifluoroacetic acid |
| 2-[(Piperidin-4-ylmethyl)-amino]-nicotinic acid methyl ester compound with trifluoro-acetic acid |