2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide
2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide structure
|
Common Name | 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide | ||
|---|---|---|---|---|
| CAS Number | 118564-58-2 | Molecular Weight | 316.48100 | |
| Density | 1.02g/cm3 | Boiling Point | 443ºC at 760mmHg | |
| Molecular Formula | C20H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 443ºC at 760mmHg |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.48100 |
| Flash Point | 221.7ºC |
| Exact Mass | 316.25100 |
| PSA | 35.83000 |
| LogP | 5.18240 |
| Vapour Pressure | 4.8E-08mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | VKFFJPOKYWQWSO-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)Nc1c(C)cc(C)cc1C)N1CCCCCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 118564-58-2? |
| A: Chinese name of 118564-58-2 is 118564-58-2. |
| Q: What is the SMILES notation of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: SMILES notation of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide is CCCC(C(=O)Nc1c(C)cc(C)cc1C)N1CCCCCC1. |
| Q: What are the upstream materials of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: Related upstream materials(CAS) of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide: 111-49-9;42768-45-6;88-05-1. |
| Q: What is the LogP of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: LogP of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide is 5.18240. |
| Q: What is the CAS number of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: CAS number of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide is 118564-58-2. |
| Q: What is the boiling point of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: Boiling point of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide is 443ºC at 760mmHg. |
| Q: What is the InChIKey of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: InChIKey of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide is VKFFJPOKYWQWSO-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: The English name of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide is 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide. |
| Q: What is the polar surface area (PSA) of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: Polar surface area (PSA) of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide is 35.83000. |
| Q: What is the molecular weight of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide? |
| A: Molecular weight of 2-(azepan-1-yl)-N-(2,4,6-trimethylphenyl)pentanamide is 316.48100. |