Transfluthrin structure
|
Common Name | Transfluthrin | ||
|---|---|---|---|---|
| CAS Number | 118712-89-3 | Molecular Weight | 371.154 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 351.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H12Cl2F4O2 | Melting Point | 32ºC | |
| MSDS | USA | Flash Point | 115.5±17.0 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of TransfluthrinTransfluthrin is a fast-acting pyrethroid insecticide and mosquito repellent. Transfluthrin is against flying insects, such as mosquito and flies, and in agriculture material pests[1][2]. |
| Name | transfluthrin |
|---|---|
| Synonym | More Synonyms |
| Description | Transfluthrin is a fast-acting pyrethroid insecticide and mosquito repellent. Transfluthrin is against flying insects, such as mosquito and flies, and in agriculture material pests[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.4±42.0 °C at 760 mmHg |
| Melting Point | 32ºC |
| Molecular Formula | C15H12Cl2F4O2 |
| Molecular Weight | 371.154 |
| Flash Point | 115.5±17.0 °C |
| Exact Mass | 370.015045 |
| PSA | 26.30000 |
| LogP | 5.40 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | DDVNRFNDOPPVQJ-HQJQHLMTSA-N |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1c(F)c(F)cc(F)c1F |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H410 |
| Precautionary Statements | P273-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant;N:Dangerousfortheenvironment; |
| Risk Phrases | R38;R50/53 |
| Safety Phrases | S36/37-S60-S61 |
| RIDADR | UN 3077 |
| HS Code | 2916209024 |
| HS Code | 2916209024 |
|---|
|
The Use of Microdispensers with Spatial Repellents for Personal Protection Against Mosquito Biting.
J. Med. Entomol. 53 , 470-2, (2016) Mosquito-borne pathogens affect millions of people worldwide. This work describes a new method to deliver spatial repellents. Functional microdispensers (FMDs) were designed to deliver spatial repelle... |
| EINECS 405-060-5 |
| 2,3,5,6-Tetrafluorobenzyl (1R)-trans-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| 2,3,5,6-Tetrafluorobenzyl (1R,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (2,3,5,6-tetrafluorophenyl)methyl ester, (1R,3S)- |
| MFCD01636115 |
| (1R-trans)-(2,3,5,6-Tetrafluorophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| (2,3,5,6-tetrafluorophenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| (2,3,5,6-tetrafluorophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| Transfluthrin (JAN) |
| 2,3,5,6-tetrafluorobenzyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| Transfluthrin |
| (2,3,5,6-tetrafluorophenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |