2,6-Dichloro-4-(trifluoromethoxy)benzaldehyde structure
|
Common Name | 2,6-Dichloro-4-(trifluoromethoxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 118754-54-4 | Molecular Weight | 259.00900 | |
| Density | 1.566g/cm3 | Boiling Point | 257ºC at 760mmHg | |
| Molecular Formula | C8H3Cl2F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.1ºC | |
| Name | 2,6-Dichloro-4-(trifluoromethoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.566g/cm3 |
|---|---|
| Boiling Point | 257ºC at 760mmHg |
| Molecular Formula | C8H3Cl2F3O2 |
| Molecular Weight | 259.00900 |
| Flash Point | 105.1ºC |
| Exact Mass | 257.94600 |
| PSA | 26.30000 |
| LogP | 3.70450 |
| Vapour Pressure | 0.0149mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | OEMRSHNCSCRBQT-UHFFFAOYSA-N |
| SMILES | O=Cc1c(Cl)cc(OC(F)(F)F)cc1Cl |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| MFCD06660298 |
| 2,6-dichloro-4-(trifluoromethoxy)benzaldehyde |