15,16-Di-O-acetyldarutoside structure
|
Common Name | 15,16-Di-O-acetyldarutoside | ||
|---|---|---|---|---|
| CAS Number | 1188282-02-1 | Molecular Weight | 568.70 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 672.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.3±25.0 °C | |
Use of 15,16-Di-O-acetyldarutoside15,16-Di-O-acetyldarutoside (compound 5) is an ent-pimarane diterpenoid compound isolated from the ethanol extract of Siegesbeckia orientalis[1]. |
| Name | 15,16-Di-O-acetyldarutoside |
|---|---|
| Synonym | More Synonyms |
| Description | 15,16-Di-O-acetyldarutoside (compound 5) is an ent-pimarane diterpenoid compound isolated from the ethanol extract of Siegesbeckia orientalis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 672.5±55.0 °C at 760 mmHg |
| Molecular Formula | C30H48O10 |
| Molecular Weight | 568.70 |
| Flash Point | 209.3±25.0 °C |
| Exact Mass | 568.324768 |
| PSA | 151.98000 |
| LogP | 3.20 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | AALUKTCMUIGJEG-PECRXMDHSA-N |
| SMILES | CC(=O)OCC(OC(C)=O)C1(C)C=C2CCC3C(C)(C)C(OC4OC(CO)C(O)C(O)C4O)CCC3(C)C2CC1 |
| Hazard Codes | Xi |
|---|
| β-D-Glucopyranoside, (2R,4aS,4bR,7S,10aS)-7-[(1R)-1,2-bis(acetyloxy)ethyl]-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,1,4a,7-tetramethyl-2-phenanthrenyl |
| (3α,5β,9β,10α,13α,15R)-3-(β-D-Glucopyranosyloxy)pimar-8(14)-ene-15,16-diyl diacetate |