2-methyl-1-oxo-1H-phenalene-3-acetic acid structure
|
Common Name | 2-methyl-1-oxo-1H-phenalene-3-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 118896-32-5 | Molecular Weight | 252.26500 | |
| Density | 1.323g/cm3 | Boiling Point | 486.6ºC at 760mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.2ºC | |
| Name | 2-(2-methyl-3-oxophenalen-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 486.6ºC at 760mmHg |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26500 |
| Flash Point | 262.2ºC |
| Exact Mass | 252.07900 |
| PSA | 54.37000 |
| LogP | 3.28430 |
| Vapour Pressure | 2.79E-10mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | YCZZTBZEHXEKHP-UHFFFAOYSA-N |
| SMILES | CC1=C(CC(=O)O)c2cccc3cccc(c23)C1=O |
|
~%
2-methyl-1-oxo-... CAS#:118896-32-5 |
| Literature: Butera, John; Bagli, Jehan; Doubleday, Wendel; Humber, Leslie; Treasurywala, Adi; et al. Journal of Medicinal Chemistry, 1989 , vol. 32, # 4 p. 757 - 765 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-methyl-1-oxo-1H-phenalene-3-acetic acid |
| 1H-Phenalene-3-acetic acid,2-methyl-1-oxo |