Olaquindox-d4 structure
|
Common Name | Olaquindox-d4 | ||
|---|---|---|---|---|
| CAS Number | 1189487-82-8 | Molecular Weight | 267.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9D4N3O4 | Melting Point | 209°C (dec.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
Use of Olaquindox-d4Olaquindox-d4is the deuterium labeledOlaquindox(HY-N0465)[1]. Olaquindox, a quinoxalin derivative, is an orally active antibiotic. Olaquindox stimulates growth and decreases intestinal mucosal immunity of piglets[2]. |
| Name | Olaquindox-d4 |
|---|---|
| Synonym | More Synonyms |
| Description | Olaquindox-d4is the deuterium labeledOlaquindox(HY-N0465)[1]. Olaquindox, a quinoxalin derivative, is an orally active antibiotic. Olaquindox stimulates growth and decreases intestinal mucosal immunity of piglets[2]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 209°C (dec.) |
|---|---|
| Molecular Formula | C12H9D4N3O4 |
| Molecular Weight | 267.27 |
| Exact Mass | 267.11600 |
| PSA | 103.74000 |
| LogP | 1.30210 |
| InChIKey | TURHTASYUMWZCC-KXGHAPEVSA-N |
| SMILES | Cc1c(C(=O)NCCO)[n+](=O)c2ccccc2n1[O-] |
| Storage condition | Refrigerator |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H334 |
| Precautionary Statements | P261-P342 + P311 |
| Hazard Codes | Xn |
| Risk Phrases | 22-42 |
| Safety Phrases | 22 |
| RIDADR | NONH for all modes of transport |
| N-[2-Hydroxy-(ethyl-d4)]-3-methyl-2-quinoxalinecarboxamide 1,4-dioxide |
| 3-methyl-4-oxido-1-oxo-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)quinoxalin-1-ium-2-carboxamide |
| Olaquindox-(ethylene-d4) |