Pyrimethamine-d3 structure
|
Common Name | Pyrimethamine-d3 | ||
|---|---|---|---|---|
| CAS Number | 1189936-99-9 | Molecular Weight | 251.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10D3ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pyrimethamine-d3Pyrimethamine-d3 (Pirimecidan-d3) is the deuterium labeled Pyrimethamine. Pyrimethamine is a medication used for protozoal infections; interferes with tetrahydrofolic acid synthesis from folic acid by inhibiting the enzyme dihydrofolate reductase (DHFR)[1][2]. |
| Name | Pyrimethamine-d3 |
|---|
| Description | Pyrimethamine-d3 (Pirimecidan-d3) is the deuterium labeled Pyrimethamine. Pyrimethamine is a medication used for protozoal infections; interferes with tetrahydrofolic acid synthesis from folic acid by inhibiting the enzyme dihydrofolate reductase (DHFR)[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
[6]. Taylor WR, et al. Antimalarial drug toxicity: a review. Drug Saf. 2004;27(1):25-61. |
| Molecular Formula | C12H10D3ClN4 |
|---|---|
| Molecular Weight | 251.73 |
| InChIKey | WKSAUQYGYAYLPV-FIBGUPNXSA-N |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1 |