2-Methyl-N-ethyl-N-(2-cyanoethyl)-4-aminobenzaldehyde structure
|
Common Name | 2-Methyl-N-ethyl-N-(2-cyanoethyl)-4-aminobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 119-97-1 | Molecular Weight | 216.279 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 418.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H16N2O | Melting Point | 64-67 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 206.6±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Methyl-N-ethyl-N-(2-cyanoethyl)-4-aminobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 418.0±40.0 °C at 760 mmHg |
| Melting Point | 64-67 °C(lit.) |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.279 |
| Flash Point | 206.6±27.3 °C |
| Exact Mass | 216.126266 |
| PSA | 44.10000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | VTXVKMVZEXXUIC-UHFFFAOYSA-N |
| SMILES | CCN(CCC#N)c1ccc(C=O)c(C)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2926909090 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Effects of novel diarylpentanoid analogues of curcumin on secretory phospholipase A2 , cyclooxygenases, lipo-oxygenase, and microsomal prostaglandin E synthase-1.
Chem. Biol. Drug Des. 83(6) , 670-81, (2014) Arachidonic acid and its metabolites have generated a heightened interest due to their significant role in inflammation. Inhibiting the enzymes involved in arachidonic acid metabolism has been conside... |
| 3-(Ethyl(4-formyl-3-methylphenyl)amino)propiononitrile |
| 3-(N-ethyl-4-formyl-3-methylanilino)propanenitrile |
| 3-[Ethyl(4-formyl-3-methylphenyl)amino]propanenitrile |
| 3-(Ethyl(4-formyl-3-methylphenyl)amino)propanenitrile |
| Propanenitrile, 3-[ethyl(4-formyl-3-methylphenyl)amino]- |
| MFCD02683509 |
| EINECS 204-362-2 |
| Propanenitrile, 3-(ethyl(4-formyl-3-methylphenyl)amino)- |
| 2-Methyl-4-[N-ethyl-N-(2-cyanoethyl)]aminobezaldehyde |