1-[(E)-furan-2-ylmethylideneamino]-3-(4-methoxyphenyl)thiourea structure
|
Common Name | 1-[(E)-furan-2-ylmethylideneamino]-3-(4-methoxyphenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 119033-86-2 | Molecular Weight | 275.32600 | |
| Density | 1.252g/cm3 | Boiling Point | 406.541ºC at 760 mmHg | |
| Molecular Formula | C13H13N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.669ºC | |
| Name | 1-[(E)-furan-2-ylmethylideneamino]-3-(4-methoxyphenyl)thiourea |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 406.541ºC at 760 mmHg |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.32600 |
| Flash Point | 199.669ºC |
| Exact Mass | 275.07300 |
| PSA | 97.92000 |
| LogP | 3.09300 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | CVZSXHJACQGDDB-NTEUORMPSA-N |
| SMILES | COc1ccc(NC(=S)NN=Cc2ccco2)cc1 |
|
~%
1-[(E)-furan-2-... CAS#:119033-86-2 |
| Literature: Tiwari, Shailendra; Nizamuddin Journal of the Indian Chemical Society, 2013 , vol. 90, # 5 p. 679 - 683 |
|
~%
1-[(E)-furan-2-... CAS#:119033-86-2 |
| Literature: Tiwari, Shailendra; Nizamuddin Journal of the Indian Chemical Society, 2013 , vol. 90, # 5 p. 679 - 683 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |