CHEMBRDG-BB 5870883 structure
|
Common Name | CHEMBRDG-BB 5870883 | ||
|---|---|---|---|---|
| CAS Number | 119061-16-4 | Molecular Weight | 228.67200 | |
| Density | 1.226g/cm3 | Boiling Point | 344.7ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 162.3ºC | |
| Name | 2-(4-chlorophenoxy)pentanoic acid |
|---|
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 344.7ºC at 760 mmHg |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67200 |
| Flash Point | 162.3ºC |
| Exact Mass | 228.05500 |
| PSA | 46.53000 |
| LogP | 2.97210 |
| Vapour Pressure | 2.46E-05mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | CBGZZDWFWLXZEU-UHFFFAOYSA-N |
| SMILES | CCCC(Oc1ccc(Cl)cc1)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |