Loureirin D structure
|
Common Name | Loureirin D | ||
|---|---|---|---|---|
| CAS Number | 119425-91-1 | Molecular Weight | 288.295 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 540.9±38.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5±20.3 °C | |
Use of Loureirin DLoureirin D is a dihydrochalcone found in dragon’s blood[1]. |
| Name | Loureirin D |
|---|---|
| Synonym | More Synonyms |
| Description | Loureirin D is a dihydrochalcone found in dragon’s blood[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 540.9±38.0 °C at 760 mmHg |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.295 |
| Flash Point | 203.5±20.3 °C |
| Exact Mass | 288.099762 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | AQMBVNGTZRFEPF-UHFFFAOYSA-N |
| SMILES | COc1cc(O)cc(O)c1CCC(=O)c1ccc(O)cc1 |
| 3-(2,4-dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one |
| 3-(2,4-Dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone |
| 1-Propanone, 3-(2,4-dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)- |