4,4'-Dihydroxy-2,6-dimethoxydihydrochalcone structure
|
Common Name | 4,4'-Dihydroxy-2,6-dimethoxydihydrochalcone | ||
|---|---|---|---|---|
| CAS Number | 151752-08-8 | Molecular Weight | 302.322 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 532.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7±23.6 °C | |
Use of 4,4'-Dihydroxy-2,6-dimethoxydihydrochalcone4,4'-Dihydroxy-2,6-dimethoxydihydrochalcone exhibits COX-1 and COX-2 inhibitory activity[1]. |
| Name | 3-(4-Hydroxy-2,6-dimethoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone |
|---|---|
| Synonym | More Synonyms |
| Description | 4,4'-Dihydroxy-2,6-dimethoxydihydrochalcone exhibits COX-1 and COX-2 inhibitory activity[1]. |
|---|---|
| Related Catalog | |
| Target |
COX-1 COX-2 |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.7±50.0 °C at 760 mmHg |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.322 |
| Flash Point | 196.7±23.6 °C |
| Exact Mass | 302.115417 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | WRSUVSOOJHAIRI-UHFFFAOYSA-N |
| SMILES | COc1cc(O)cc(OC)c1CCC(=O)c1ccc(O)cc1 |
| Water Solubility | Practically insoluble (0.094 g/L) (25 ºC) |
| 1-Propanone, 3-(4-hydroxy-2,6-dimethoxyphenyl)-1-(4-hydroxyphenyl)- |
| 3-(4-Hydroxy-2,6-dimethoxyphenyl)-1-(4-hydroxyphenyl)-1-propanone |
| 3-(4-hydroxy-2,6-dimethoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one |
| Loureirin D |