N-ethyl-N-propan-2-ylpropan-2-amine,(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid structure
|
Common Name | N-ethyl-N-propan-2-ylpropan-2-amine,(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 1194607-27-6 | Molecular Weight | 323.42700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H29NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-ethyl-N-propan-2-ylpropan-2-amine,(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H29NO4 |
|---|---|
| Molecular Weight | 323.42700 |
| Exact Mass | 323.21000 |
| PSA | 70.00000 |
| LogP | 3.62370 |
| InChIKey | NASCFFQCKVFULR-WGCWOXMQSA-N |
| SMILES | CCN(C(C)C)C(C)C.COc1cc(C=CC(=O)O)ccc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
Towards a Second Generation of Ionic Liquid Matrices (ILMs) for MALDI-MS of Peptides, Proteins, and Carbohydrates
J. Am. Soc. Mass Spectrom. 20 , 1790-1800, (2009) Second generation ionic liquid matrices are developed, examined, and tested. They have shown a wide mass detection range (<1000 Da to >270,000 Da) for proteins and peptides with greater S/N ratios tha... |
| N,N-Diisopropylethylammonium ferulate |
| N,N-Diisopropylethylammonium 4-hydroxy-3-methoxycinnamate |
| Ferulic acid N-ethyl-N,N-diisopropylammonium salt |