(5-Chloro-2-(trifluoromethyl)phenyl)boronic acid structure
|
Common Name | (5-Chloro-2-(trifluoromethyl)phenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 1195945-67-5 | Molecular Weight | 224.37300 | |
| Density | 1.49±0.1 g/cm3(Predicted) | Boiling Point | 313.7±52.0 °C(Predicted) | |
| Molecular Formula | C7H5BClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-Chloro-2-(trifluoromethyl)phenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 313.7±52.0 °C(Predicted) |
| Molecular Formula | C7H5BClF3O2 |
| Molecular Weight | 224.37300 |
| Exact Mass | 224.00200 |
| PSA | 40.46000 |
| LogP | 1.03860 |
| InChIKey | ILPIBSAMAZDGRC-UHFFFAOYSA-N |
| SMILES | OB(O)c1cc(Cl)ccc1C(F)(F)F |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [5-chloro-2-(trifluoromethyl)phenyl]boronic acid |