quizalofop-P-tefuryl structure
|
Common Name | quizalofop-P-tefuryl | ||
|---|---|---|---|---|
| CAS Number | 119738-06-6 | Molecular Weight | 428.866 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 579.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H21ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.3±30.1 °C | |
| Name | quizalofop-P-tefuryl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 579.6±50.0 °C at 760 mmHg |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.866 |
| Flash Point | 304.3±30.1 °C |
| Exact Mass | 428.113892 |
| PSA | 79.77000 |
| LogP | 4.09 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | BBKDWPHJZANJGB-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1)C(=O)OCC1CCCO1 |
| Storage condition | 0-6°C |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R61 |
| Safety Phrases | 53-45-60-61 |
|
~%
quizalofop-P-tefuryl CAS#:119738-06-6 |
| Literature: US6136977 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Propanoic acid, 2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]-, (tetrahydro-2-furanyl)methyl ester |
| T66 BN ENJ HG COR DOY1&VO1- BT5OTJ &&R Form |
| UNII:EB75I82DU0 |
| (RS)-tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenoxy]propionate |
| Tetrahydro-2-furanylmethyl (2R)-2-{4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy}propanoate |
| Tetrahydrofuran-2-ylmethyl 2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate |
| Tetrahydro-2-furanylmethyl 2-{4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy}propanoate |
| ubi c4874 |
| EINECS 414-200-4 |
| [(2Ξ)-oxolan-2-yl]methyl (2R)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate |
| Quizalofop-P-tefuryl |
| MFCD08273848 |
| Propanoic acid, 2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]-, (tetrahydro-2-furanyl)methyl ester, (2R)- |
| tetrahydrofuran-2-ylmethyl (2R)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate |
| (tetrahydro-2-furanyl)methyl (2R)-2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]propanoate |