MK912 structure
|
Common Name | MK912 | ||
|---|---|---|---|---|
| CAS Number | 119942-70-0 | Molecular Weight | 375.892 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MK912MK-912 is a potent new selective alpha 2-adrenergic receptor antagonist that is active orally, to study the effect of short-term, selective alpha 2-blockade on fasting plasma glucose (FPG) and pancreatic islet function in non-insulin-dependent diabetes (NIDDM). |
| Name | 4A6522ZKT5 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H26ClN3O2 |
|---|---|
| Molecular Weight | 375.892 |
| Exact Mass | 375.171356 |
| InChIKey | ALYCEQJIRFYVGE-VASSOYJASA-N |
| SMILES | CN1CCC2(CCN3CCc4c(oc5ccccc45)C3C2)N(C)C1=O.Cl |
| Spiro[2H-benzofuro[2,3-a]quinolizine-2,4'(1'H)-pyrimidin]-2'(3'H)-one, 1,3,4,5',6,6',7,12b-octahydro-1',3'-dimethyl-, (2S,12bS)-, hydrochloride (1:1) |
| MK-912 HYDROCHLORIDE |
| (2S,12bS)-1',3'-Dimethyl-1,3,4,5',6,6',7,12b-octahydro-1'H-spiro[1-benzofuro[2,3-a]quinolizine-2,4'-pyrimidin]-2'(3'H)-one hydrochloride (1:1) |
| 4A6522ZKT5 |