3-Amino-4-methoxy-N-phenylbenzamide structure
|
Common Name | 3-Amino-4-methoxy-N-phenylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 120-35-4 | Molecular Weight | 242.273 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 364.5±32.0 °C at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | 154-156°C | |
| MSDS | N/A | Flash Point | 174.3±25.1 °C | |
| Name | 3-Amino-4-methoxybenzanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.5±32.0 °C at 760 mmHg |
| Melting Point | 154-156°C |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.273 |
| Flash Point | 174.3±25.1 °C |
| Exact Mass | 242.105530 |
| PSA | 64.35000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | LHMQDVIHBXWNII-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1N |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RTECS | CV7400000 |
| HS Code | 2924299090 |
|
~78%
3-Amino-4-metho... CAS#:120-35-4 |
| Literature: Toms River Chemical Corporation Patent: US4283556 A1, 1981 ; |
|
~77%
3-Amino-4-metho... CAS#:120-35-4 |
| Literature: Hao, Lan-Hu; Li, Yan-Ping; He, Wei-Ying; Wang, Hui-Qiang; Shan, Guang-Zhi; Jiang, Jian-Dong; Li, Yu-Huan; Li, Zhuo-Rong European Journal of Medicinal Chemistry, 2012 , vol. 55, p. 117 - 124 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 3-Amino-p-anisanilide |
| MFCD00017166 |
| 3-Amino-4-Methoxybenzanilide |
| EINECS 204-388-4 |
| 3-Amino-4-methoxy-N-phenylbenzamide |