Desoxyanisoin structure
|
Common Name | Desoxyanisoin | ||
|---|---|---|---|---|
| CAS Number | 120-44-5 | Molecular Weight | 256.296 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 415.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | 110-112 °C(lit.) | |
| MSDS | USA | Flash Point | 196.9±9.6 °C | |
| Name | Deoxyanisoin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.6±25.0 °C at 760 mmHg |
| Melting Point | 110-112 °C(lit.) |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.296 |
| Flash Point | 196.9±9.6 °C |
| Exact Mass | 256.109955 |
| PSA | 35.53000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | SICBLYCPRWNHHP-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)c2ccc(OC)cc2)cc1 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00008406 |
| Acetophenone, 4'-methoxy-2- (p-methoxyphenyl)- |
| 1,2-Bis(4-methoxyphenyl)ethanone |
| DESOXYANISOIN |
| EINECS 204-396-8 |
| Ethanone, 1,2-bis(4-methoxyphenyl)- |
| 4'-Methoxy-2-(4-methoxyphenyl)acetophenone |