8-Bromo-4-hydroxy-2-methylquinoline structure
|
Common Name | 8-Bromo-4-hydroxy-2-methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 1201-08-7 | Molecular Weight | 238.08100 | |
| Density | 1.523g/cm3 | Boiling Point | 325.4ºC at 760mmHg | |
| Molecular Formula | C10H8BrNO | Melting Point | N/A | |
| MSDS | USA | Flash Point | 150.6ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 8-bromo-2-methyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.523g/cm3 |
|---|---|
| Boiling Point | 325.4ºC at 760mmHg |
| Molecular Formula | C10H8BrNO |
| Molecular Weight | 238.08100 |
| Flash Point | 150.6ºC |
| Exact Mass | 236.97900 |
| PSA | 33.12000 |
| LogP | 3.01130 |
| Vapour Pressure | 0.00023mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | VZEQVJZHDYRCBZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2cccc(Br)c2[nH]1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933499090 |
|
~%
8-Bromo-4-hydro... CAS#:1201-08-7 |
| Literature: Medicinal Chemistry Research, , vol. 21, # 10 p. 3073 - 3079,7 |
|
~%
8-Bromo-4-hydro... CAS#:1201-08-7 |
| Literature: Medicinal Chemistry Research, , vol. 21, # 10 p. 3073 - 3079,7 |
|
~%
8-Bromo-4-hydro... CAS#:1201-08-7 |
| Literature: Journal of the Karnatak University, , vol. 1, p. 23,26 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Brom-2-methyl-chinolin-4-ol |
| MFCD00484434 |
| 2-methyl-4-hydroxy-8-bromo-quinoline |
| 8-Bromo-2-methylquinolin-4-ol |
| 8-Brom-4-hydroxychinaldin |
| 8-bromo-2-methyl-4-quinolinol |
| 8-bromo-4-hydroxy-2-methylquinoline |