2,6-ditert-butyl-4-(trifluoromethyl)phenol structure
|
Common Name | 2,6-ditert-butyl-4-(trifluoromethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 120120-40-3 | Molecular Weight | 274.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-(trifluoromethyl)phenol |
|---|
| Molecular Formula | C15H21F3O |
|---|---|
| Molecular Weight | 274.32200 |
| Exact Mass | 274.15400 |
| PSA | 20.23000 |
| LogP | 5.00600 |
| InChIKey | DCKKVAZBNUYJKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(F)(F)F)cc(C(C)(C)C)c1O |
|
~86%
2,6-ditert-buty... CAS#:120120-40-3 |
| Literature: Stahly, G. Patrick; Bell, Donald R. Journal of Organic Chemistry, 1989 , vol. 54, # 12 p. 2873 - 2877 |
|
~%
2,6-ditert-buty... CAS#:120120-40-3 |
| Literature: Medebielle, Maurice; Pinson, Jean; Saveant, Jean-Michel Journal of the American Chemical Society, 1991 , vol. 113, # 18 p. 6872 - 6879 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |