2,6-ditert-butyl-4-(chloromethyl)phenol structure
|
Common Name | 2,6-ditert-butyl-4-(chloromethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 955-01-1 | Molecular Weight | 254.79600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-(chloromethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23ClO |
|---|---|
| Molecular Weight | 254.79600 |
| Exact Mass | 254.14400 |
| PSA | 20.23000 |
| LogP | 4.72600 |
| InChIKey | TXBWKXFDLINCMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CCl)cc(C(C)(C)C)c1O |
|
~97%
2,6-ditert-buty... CAS#:955-01-1 |
| Literature: De Caro, Pascale Satge; Mouloungui, Zephirin; Gaset, Antoine JAOCS, Journal of the American Oil Chemists' Society, 1997 , vol. 74, # 3 p. 241 - 247 |
|
~82%
2,6-ditert-buty... CAS#:955-01-1 |
| Literature: Ziakas, George N.; Rekka, Eleni A.; Gavalas, Antonios M.; Eleftheriou, Phaedra T.; Kourounakis, Panos N. Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 16 p. 5616 - 5624 |
| 4-hydroxy-3,5-di-tert-butylbenzal chloride |
| 4-hydroxy-3,5-ditertiary-butyl-benzyl chloride |
| Phenol,4-(chloromethyl)-2,6-bis(1,1-dimethylethyl) |
| 2,6-di-tert-butyl-4-chloromethylphenol |
| 4-chloromethyl-2,6-di-t-butylphenol |
| 3,5-di-tert-butyl-4-hydroxybenzyl chloride |
| 4-hydroxy-3,5-di-tert-butylbenzyl chloride |