Quinupristin structure
|
Common Name | Quinupristin | ||
|---|---|---|---|---|
| CAS Number | 120138-50-3 | Molecular Weight | 1022.22000 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C53H67N9O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of QuinupristinQuinupristin is a streptogramin antibiotic. Quinupristin blocks peptide bond synthesis to prevent the extension of polypeptide chains and promote the detachment of incomplete protein chains in the bacterial ribosomal subunits[1] [2]. |
| Name | Quinupristin |
|---|
| Description | Quinupristin is a streptogramin antibiotic. Quinupristin blocks peptide bond synthesis to prevent the extension of polypeptide chains and promote the detachment of incomplete protein chains in the bacterial ribosomal subunits[1] [2]. |
|---|---|
| Related Catalog | |
| In Vitro | Quinupristin/dalfopristin is a combination of streptogramin antibiotics used to against infections.Quinupristin/dalfopristin targets the 23S rRNA of most Gram-positive bacteria as well as those of certain Gram-negative bacteria[1]. Quinupristin/dalfopristin is reportedly effective against Mycoplasma spp[1]. |
| References |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C53H67N9O10S |
| Molecular Weight | 1022.22000 |
| Exact Mass | 1021.47000 |
| PSA | 256.50000 |
| LogP | 3.12360 |
| Index of Refraction | 1.662 |
| InChIKey | WTHRRGMBUAHGNI-KNIYECGFSA-N |
| SMILES | CCC1NC(=O)C(NC(=O)c2ncccc2O)C(C)OC(=O)C(c2ccccc2)NC(=O)C2CC(=O)C(CSC3CN4CCC3CC4)CN2C(=O)C(Cc2ccc(N(C)C)cc2)N(C)C(=O)C2CCCN2C1=O |