(2R,3R)-BOC-dolaproine structure
|
Common Name | (2R,3R)-BOC-dolaproine | ||
|---|---|---|---|---|
| CAS Number | 120205-50-7 | Molecular Weight | 287.352 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 397.8±17.0 °C at 760 mmHg | |
| Molecular Formula | C14H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4±20.9 °C | |
Use of (2R,3R)-BOC-dolaproineN-Boc-dolaproine (Dap) is the amino acid residue of the pentapeptide Dolastatin 10 (HY-15580). Dolastatin 10 inhibits tubulin polymerization and mitosis and has anticancer activity[1]. |
| Name | (2R,3R)-3-((S)-1-(tert-Butoxycarbonyl)pyrrolidin-2-yl)-3-methoxy-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-dolaproine (Dap) is the amino acid residue of the pentapeptide Dolastatin 10 (HY-15580). Dolastatin 10 inhibits tubulin polymerization and mitosis and has anticancer activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.8±17.0 °C at 760 mmHg |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.352 |
| Flash Point | 194.4±20.9 °C |
| Exact Mass | 287.173279 |
| PSA | 76.07000 |
| LogP | 1.36 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | LNEHHTWYEBGHBY-OUAUKWLOSA-N |
| SMILES | COC(C(C)C(=O)O)C1CCCN1C(=O)OC(C)(C)C |
| (2R,3R)-3-Methoxy-2-methyl-3-[(2S)-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-pyrrolidinyl]propanoic acid |
| 2-Pyrrolidinepropanoic acid, 1-[(1,1-dimethylethoxy)carbonyl]-β-methoxy-α-methyl-, (αR,βR,2S)- |
| (2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid |
| ((2R,3R)-3-((S)-1-(tertbutoxycarbonyl)pyrrolidin-2-yl)-3-Methoxy-2-Methylpropanoic acid |