1β-Hydroxyeuscaphic acid structure
|
Common Name | 1β-Hydroxyeuscaphic acid | ||
|---|---|---|---|---|
| CAS Number | 120211-98-5 | Molecular Weight | 518.73 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 619.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C31H50O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.2±28.0 °C | |
Use of 1β-Hydroxyeuscaphic acid1β-Hydroxyeuscaphic acid has significant hepatoprotective activity by lowering the leakage of intracellular enzymes, reducing the oxidation of proteins and decreasing the incidence of apoptosis[1]. |
| Name | (1R,2R,4aS,6aS,6bR,8aS,10S,11S,12S,12aR,12bS,14bS)-1,10,11,12-tetrahydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadecahydropicene-4a(2H)-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 1β-Hydroxyeuscaphic acid has significant hepatoprotective activity by lowering the leakage of intracellular enzymes, reducing the oxidation of proteins and decreasing the incidence of apoptosis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 619.1±55.0 °C at 760 mmHg |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.73 |
| Flash Point | 342.2±28.0 °C |
| Exact Mass | 504.345093 |
| PSA | 118.22000 |
| LogP | 5.27 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | VULLSLYDWNGNKZ-HMBKWFJRSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)C(O)C(O)C(O)C(C)(C)C5CCC43C)C2C1(C)O |
| Hazard Codes | Xi |
|---|
| (1β,2α,3α)-1,2,3,19-Tetrahydroxyurs-12-en-28-oic acid |
| Urs-12-en-28-oic acid, 1,2,3,19-tetrahydroxy-, (1β,2α,3α)- |