2,4(1H,3H)-Pyrimidinedione,6-chloro-1,3-dimethyl-5-nitro- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-chloro-1,3-dimethyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 1203-25-4 | Molecular Weight | 219.58300 | |
| Density | 1.64g/cm3 | Boiling Point | 243.8ºC at 760mmHg | |
| Molecular Formula | C6H6ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.2ºC | |
| Name | 6-chloro-1,3-dimethyl-5-nitropyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 243.8ºC at 760mmHg |
| Molecular Formula | C6H6ClN3O4 |
| Molecular Weight | 219.58300 |
| Flash Point | 101.2ºC |
| Exact Mass | 219.00500 |
| PSA | 89.82000 |
| LogP | 0.16880 |
| Vapour Pressure | 0.0315mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | ZOPMTVMJANWXKJ-UHFFFAOYSA-N |
| SMILES | Cn1c(Cl)c([N+](=O)[O-])c(=O)n(C)c1=O |
|
~98%
2,4(1H,3H)-Pyri... CAS#:1203-25-4 |
| Literature: Kuz'menko, V. V.; Kuz'menko, T. A.; Aleksandrov, G. G.; Pozharskii, A. F.; Gulevskaya, A. V. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1987 , vol. 23, # 6 p. 690 - 697 Khimiya Geterotsiklicheskikh Soedinenii, 1987 , vol. 23, # 6 p. 836 - 844 |
|
~%
2,4(1H,3H)-Pyri... CAS#:1203-25-4 |
| Literature: GLENMARK PHARMACEUTICALS S.A.; CHAUDHARI, Sachin, Sundarlal; KUMAR, Sukeerthi; THOMAS, Abraham; PATIL, Nisha, Parag; KADAM, Ashok, Bhausaheb; WAGHMARE, Nayan, Taterao; KHAIRATKAR-JOSHI, Neelima; MUKHOPADHYAY, Indranil Patent: WO2011/114184 A1, 2011 ; WO 2011/114184 A1 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| 6-chloro-5-nitro-1,3-dimethyluracil |
| 6-chloro-1,3-dimethyl-5-nitro-1H-pyrimidine-2,4-dione |
| 6-chloro-1,3-dimethyl-5-nitrouracil |
| 1,3-Dimethyl-5-nitro-6-chlorouracil |
| 6-Chlor-1,3-dimethyl-5-nitrouracil |