1,3,9-Trimethyluric acid structure
|
Common Name | 1,3,9-Trimethyluric acid | ||
|---|---|---|---|---|
| CAS Number | 7464-93-9 | Molecular Weight | 210.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1,3,9-Trimethyluric acid1,3,9-Trimethyluric acid is a natural alkaloid compound[1]. |
| Name | 1,3,9-trimethyl-7H-purine-2,6,8-trione |
|---|---|
| Synonym | More Synonyms |
| Description | 1,3,9-Trimethyluric acid is a natural alkaloid compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C8H10N4O3 |
|---|---|
| Molecular Weight | 210.19 |
| Exact Mass | 210.07500 |
| PSA | 81.79000 |
| InChIKey | CWENCZHQIWXCCA-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(=O)n(C)c2n(C)c1=O |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,9-trimethyl-7,9-dihydro-3H-purine-2,6,8-trione |
| 1,3,9-TRIMETHYLURIC ACID |
| 1,3,9-trimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| 7,9-dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione |
| 1,3,9-Trimethyl-harnsaeure |