Cyclotraxin B structure
|
Common Name | Cyclotraxin B | ||
|---|---|---|---|---|
| CAS Number | 1203586-72-4 | Molecular Weight | 1200.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C48H73N13O17S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cyclotraxin BCyclotraxin B, a cyclic peptide, is a highly potent and selective TrkB inhibitor without altering the binding of BDNF. Cyclotraxin B non-competitively inhibits BDNF-induced TrkB activity with an IC50 of 0.30 nM. Cyclotraxin B can crosse the blood-brain-barrier and has analgesic and anxiolytic-like behavioral effects[1][2][3]. |
| Name | Cyclotraxin B |
|---|
| Description | Cyclotraxin B, a cyclic peptide, is a highly potent and selective TrkB inhibitor without altering the binding of BDNF. Cyclotraxin B non-competitively inhibits BDNF-induced TrkB activity with an IC50 of 0.30 nM. Cyclotraxin B can crosse the blood-brain-barrier and has analgesic and anxiolytic-like behavioral effects[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C48H73N13O17S3 |
|---|---|
| Molecular Weight | 1200.37 |
| InChIKey | JLBMMJHZUYBFGX-ZHTCEXBHSA-N |
| SMILES | CSCCC1NC(=O)C2CCCN2C(=O)C(CC(N)=O)NC(=O)C(N)CSSCC(C(=O)O)NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(C(C)O)NC(=O)C(Cc2ccc(O)cc2)NC(=O)CNC1=O |
| Hazard Codes | Xi |
|---|