2-Methyl-4,6,8-trichloroquinoline structure
|
Common Name | 2-Methyl-4,6,8-trichloroquinoline | ||
|---|---|---|---|---|
| CAS Number | 1204-14-4 | Molecular Weight | 246.520 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 324.2±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H6Cl3N | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 179.7±12.1 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 4,6,8-trichloro-2-methylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 324.2±37.0 °C at 760 mmHg |
| Molecular Formula | C10H6Cl3N |
| Molecular Weight | 246.520 |
| Flash Point | 179.7±12.1 °C |
| Exact Mass | 244.956589 |
| PSA | 12.89000 |
| LogP | 4.21 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | MLCCGRNOVHTMML-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c2cc(Cl)cc(Cl)c2n1 |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318-H413 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6,8-Trichlor-chinaldin |
| 2-Methyl-4,6,8-trichloroquinoline |
| 4,6,8-trichloro-2-methyl-quinoline |
| QU136 |
| 4,6,8-TRICHLOROQUINALDINE |
| 4,6,8-Trichloro-2-methylquinoline |
| 2-methyl-4,6,8-trichloro-quinoline |
| Quinoline, 4,6,8-trichloro-2-methyl- |