Lophanthoidin B structure
|
Common Name | Lophanthoidin B | ||
|---|---|---|---|---|
| CAS Number | 120462-42-2 | Molecular Weight | 448.506 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 564.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H32O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.4±23.6 °C | |
Use of Lophanthoidin BLophanthoidin B is a diterpenoids compound isolated from the dried leaves of Rabdosia lophanthoides[1]. |
| Name | (6β,7α)-6,12-Dihydroxy-11,14-dioxoabieta-8,12-diene-7,16-diyl dia cetate |
|---|---|
| Synonym | More Synonyms |
| Description | Lophanthoidin B is a diterpenoids compound isolated from the dried leaves of Rabdosia lophanthoides[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. XuYunlong, et al. Abietane quinones from rabdosia lophanthoides. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 564.0±50.0 °C at 760 mmHg |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.506 |
| Flash Point | 185.4±23.6 °C |
| Exact Mass | 448.209717 |
| PSA | 127.20000 |
| LogP | 4.60 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | FOQUQAGAAHKGMV-WHYCVTRCSA-N |
| SMILES | CC(=O)OCC(C)C1=C(O)C2=C(C(=O)C1=O)C1(C)CCCC(C)(C)C1C(O)C2OC(C)=O |
| Hazard Codes | Xi |
|---|
| (6β,7α)-6,12-Dihydroxy-11,14-dioxoabieta-8,12-diene-7,16-diyl diacetate |
| 1,4-Phenanthrenedione, 10-(acetyloxy)-2-[2-(acetyloxy)-1-methylethyl]-4b,5,6,7,8,8a,9,10-octahydro-3,9-dihydroxy-4b,8,8-trimethyl-, (4bS,8aS,9S,10S)- |