Lophanthoidin E structure
|
Common Name | Lophanthoidin E | ||
|---|---|---|---|---|
| CAS Number | 120462-45-5 | Molecular Weight | 406.469 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 551.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H30O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.4±23.6 °C | |
Use of Lophanthoidin ELophanthoidin E is a diterpenoids compound isolated from the dried leaves of Rabdosia lophanthoides[1]. |
| Name | (6β,7α)-6,7,12-Trihydroxy-11,14-dioxoabieta-8,12-dien-16-yl aceta te |
|---|---|
| Synonym | More Synonyms |
| Description | Lophanthoidin E is a diterpenoids compound isolated from the dried leaves of Rabdosia lophanthoides[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. XuYunlong, et al. Abietane quinones from rabdosia lophanthoides. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 551.3±50.0 °C at 760 mmHg |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.469 |
| Flash Point | 186.4±23.6 °C |
| Exact Mass | 406.199158 |
| PSA | 121.13000 |
| LogP | 4.34 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | NHVNNHGOOVAQDU-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(C)C1=C(O)C2=C(C(=O)C1=O)C1(C)CCCC(C)(C)C1C(O)C2O |
| Hazard Codes | Xi |
|---|
| (6β,7α)-6,7,12-Trihydroxy-11,14-dioxoabieta-8,12-dien-16-yl acetate |
| 1,4-Phenanthrenedione, 2-[2-(acetyloxy)-1-methylethyl]-4b,5,6,7,8,8a,9,10-octahydro-3,9,10-trihydroxy-4b,8,8-trimethyl-, (4bS,8aS,9S,10S)- |