Ganoderenic acid F structure
|
Common Name | Ganoderenic acid F | ||
|---|---|---|---|---|
| CAS Number | 120462-47-7 | Molecular Weight | 510.62 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 687.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H38O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 383.6±28.0 °C | |
Use of Ganoderenic acid FGanoderenic acid F (compound 17) is a triterpenoid that can be found in ganoderma lucidum[1]. |
| Name | Ganoderenic acid F |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderenic acid F (compound 17) is a triterpenoid that can be found in ganoderma lucidum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 687.7±55.0 °C at 760 mmHg |
| Molecular Formula | C30H38O7 |
| Molecular Weight | 510.62 |
| Flash Point | 383.6±28.0 °C |
| Exact Mass | 510.261749 |
| LogP | 2.94 |
| Vapour Pressure | 0.0±4.6 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | QXLYRDZEWGVGFS-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3=O |
| Lanosta-8,20(22)-dien-26-oic acid, 3,7,11,15,23-pentaoxo-, (5ξ,20Z,25R)- |
| (5ξ,20Z,25R)-3,7,11,15,23-Pentaoxolanosta-8,20(22)-dien-26-oic acid |