Ganoderenic acid A structure
|
Common Name | Ganoderenic acid A | ||
|---|---|---|---|---|
| CAS Number | 100665-40-5 | Molecular Weight | 514.65000 | |
| Density | 1.24g/cm3 | Boiling Point | 700.3ºC at 760mmHg | |
| Molecular Formula | C30H42O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.3ºC | |
Use of Ganoderenic acid AGanoderenic acid A is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderenic acid A is a potent inhibitor of β-glucuronidase. Ganoderenic acid A has a potent hepatoprotective effect against CCl4-induced liver injury[1]. |
| Name | (E)-6-[(7S,10S,13R,14R,15S,17R)-7,15-dihydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxohept-5-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderenic acid A is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderenic acid A is a potent inhibitor of β-glucuronidase. Ganoderenic acid A has a potent hepatoprotective effect against CCl4-induced liver injury[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 700.3ºC at 760mmHg |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.65000 |
| Flash Point | 391.3ºC |
| Exact Mass | 514.29300 |
| PSA | 128.97000 |
| LogP | 4.05160 |
| Vapour Pressure | 1.12E-22mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | OVUOUFPIPZJGME-GDNBJRDFSA-N |
| SMILES | CC(=CC(=O)CC(C)C(=O)O)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3O |
| Lanosta-8,20(22)-dien-26-oic acid,7,15-dihydroxy-3,11,23-trioxo-,(7beta,15alpha,20E) |
| Ganoderenic Acid A |