8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate
![8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate Structure](https://image.chemsrc.com/caspic/442/1204809-89-1.png)
8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate structure
|
Common Name | 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1204809-89-1 | Molecular Weight | 253.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO4 |
|---|---|
| Molecular Weight | 253.29 |
| Exact Mass | 253.13140809 |
| PSA | 69.67000 |
| LogP | 0.77240 |
| InChIKey | FDEKZKWYTOTCTN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C=C(C2)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
8-[(2-methylpro... CAS#:1204809-89-1 |
| Literature: SANOFI-AVENTIS Patent: US2011/294809 A1, 2011 ; Location in patent: Page/Page column 13 ; |
|
~%
8-[(2-methylpro... CAS#:1204809-89-1 |
| Literature: SANOFI-AVENTIS Patent: US2011/294809 A1, 2011 ; |
![8-BOC-3-(TRIFLUOROMETHYLSULFONYLOXY)-8-AZABICYCLO[3.2.1]OCT-3-ENE structure](https://image.chemsrc.com/caspic/163/185099-68-7.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1204809-89-1? |
| A: Chinese name of 1204809-89-1 is 1204809-89-1. |
| Q: What are the upstream materials of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: Related upstream materials(CAS) of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate: 13939-06-5;185099-68-7;185099-67-6. |
| Q: What is the SMILES notation of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: SMILES notation of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate is CC(C)(C)OC(=O)N1C2CCC1C=C(C2)C(=O)O. |
| Q: What is the English name of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: The English name of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate is 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate. |
| Q: What is the molecular weight of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: Molecular weight of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate is 253.29. |
| Q: What is the InChIKey of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: InChIKey of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate is FDEKZKWYTOTCTN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: CAS number of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate is 1204809-89-1. |
| Q: What is the LogP of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: LogP of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate is 0.77240. |
| Q: What is the polar surface area (PSA) of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: Polar surface area (PSA) of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate is 69.67000. |
| Q: What is the molecular formula of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate? |
| A: Molecular formula of 8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]oct-3-ene-3-carboxylate is C13H19NO4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |