N-Boc-Nortropinone structure
|
Common Name | N-Boc-Nortropinone | ||
|---|---|---|---|---|
| CAS Number | 185099-67-6 | Molecular Weight | 225.284 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 325.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO3 | Melting Point | 70-74 °C | |
| MSDS | USA | Flash Point | 150.8±25.9 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | tert-butyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 325.8±35.0 °C at 760 mmHg |
| Melting Point | 70-74 °C |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.284 |
| Flash Point | 150.8±25.9 °C |
| Exact Mass | 225.136490 |
| PSA | 46.61000 |
| LogP | 0.80 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | MENILFUADYEXNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(=O)C2 |
| Storage condition | Store at 0-5°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~95%
N-Boc-Nortropinone CAS#:185099-67-6 |
| Literature: Gong, Leyi; Hogg, J. Heather; Collier, James; Wilhelm, Robert S.; Soderberg, Carol Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 20 p. 3597 - 3600 |
|
~%
N-Boc-Nortropinone CAS#:185099-67-6 |
| Literature: US2006/100426 A1, ; Page/Page column 18 ; US 20060100426 A1 |
|
~99%
N-Boc-Nortropinone CAS#:185099-67-6 |
| Literature: Roche Palo Alto LLC Patent: US2009/318493 A1, 2009 ; Location in patent: Page/Page column 41-42 ; US 20090318493 A1 |
|
~83%
N-Boc-Nortropinone CAS#:185099-67-6 |
| Literature: Pfizer Inc. Patent: US2002/119961 A1, 2002 ; |
|
~73%
N-Boc-Nortropinone CAS#:185099-67-6 |
| Literature: Bezencon, Olivier; Bur, Daniel; Corminboeuf, Olivier; Dube, Daniel; Grisostomi, Corinna; MacDonald, Dwight; McKay, Dan; Powell, David; Remen, Lubos; Richard-Bildstein, Sylvia; Scheigetz, John; Therien, Michel; Weller, Thomas Patent: US2009/176823 A1, 2009 ; Location in patent: Page/Page column 28 ; |
|
~75%
N-Boc-Nortropinone CAS#:185099-67-6 |
| Literature: ACTELION PHARMACEUTICALS LTD Patent: WO2007/88514 A1, 2007 ; Location in patent: Page/Page column 75-76 ; WO 2007/088514 A1 |
|
~%
N-Boc-Nortropinone CAS#:185099-67-6 |
| Literature: US2007/167442 A1, ; Page/Page column 45 ; |
|
~%
N-Boc-Nortropinone CAS#:185099-67-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 21 p. 5281 - 5284 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Ghosh S, et al.
Can. J. Chem. 84(4) , 555-560, (2006)
|
| 2-Methyl-2-propanyl (1R,5S)-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate |
| N-(tert-Butoxycarbonyl)nortropinone |
| N-Boc-nortropinone |
| MFCD00673779 |
| 8-Azabicyclo[3.2.1]octane-8-carboxylic acid, 3-oxo-, 1,1-dimethylethyl ester, (1R,5S)- |
| 2-Methyl-2-propanyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate |
| tert-butyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate |
| 8-Azabicyclo[3.2.1]octane-8-carboxylic acid, 3-oxo-, 1,1-dimethylethyl ester |
| 8-Boc-3-oxo-8-azabicyclo[3.2.1]octane |
| N-Boc-4-Nortropinone |
| N-(tert-Butoxycarbonyl)-8-azabicyclo[3.2.1]octan-3-one |
| Boc-nortropinone |