2-bromo-4-nitropropiophenone structure
|
Common Name | 2-bromo-4-nitropropiophenone | ||
|---|---|---|---|---|
| CAS Number | 1205-56-7 | Molecular Weight | 258.06900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-4-nitropropiophenone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8BrNO3 |
|---|---|
| Molecular Weight | 258.06900 |
| Exact Mass | 256.96900 |
| PSA | 62.89000 |
| LogP | 3.08410 |
| InChIKey | KENDQBRWAPDVHD-UHFFFAOYSA-N |
| SMILES | CC(Br)C(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
|
~10%
2-bromo-4-nitro... CAS#:1205-56-7 |
| Literature: Hirst, Gavin C.; Arnold, Lee D.; Burchat, Andrew; Wishart, Neil; Calderwood, David; Wada, Carol K.; Michaelides, Michael R.; Ji, Zhiqin; Muckey, Melanie Patent: US2003/225098 A1, 2003 ; Location in patent: Page 34 ; US 20030225098 A1 |
|
~0%
2-bromo-4-nitro... CAS#:1205-56-7 |
| Literature: Moorthy, Jarugu Narasimha; Senapati, Kalyan; Singhal, Nidhi Tetrahedron Letters, 2009 , vol. 50, # 21 p. 2493 - 2496 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-1-(4-morpholinophenol)ethanone |
| 2-BROMO-1-(4-MORPHOLINOPHENYL)ETHANONE |
| 2-Bromo-1-(4-morpholinophenyl)-1-ethanone |
| 2-Bromo-1-(4-nitro-phenyl)-propan-1-one |
| 2-bromo-1-(4-morpholinophenyl)ethan-1-one |
| 2-bromo-1-(4-morpholin-4-yl-phenyl)-ethanone |