1-(4-Nitrophenyl)-1,2-propanedione structure
|
Common Name | 1-(4-Nitrophenyl)-1,2-propanedione | ||
|---|---|---|---|---|
| CAS Number | 6159-25-7 | Molecular Weight | 193.15600 | |
| Density | 1.319 g/cm3 | Boiling Point | 341.6ºC at 760 mmHg | |
| Molecular Formula | C9H7NO4 | Melting Point | 86-88ºC | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | 1-(4-Nitrophenyl)-1,2-propanedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319 g/cm3 |
|---|---|
| Boiling Point | 341.6ºC at 760 mmHg |
| Melting Point | 86-88ºC |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.15600 |
| Flash Point | 170.5ºC |
| Exact Mass | 193.03800 |
| PSA | 79.96000 |
| LogP | 1.88970 |
| Index of Refraction | 1.517 |
| InChIKey | WCQBWJSIZYUMDJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-(4-nitro-phenyl)-propane-1,2-dione |
| 4-(2-Oxopropanoyl)nitrobenzene |
| 1-(4-Nitro-phenyl)-propan-1,2-dion |
| MFCD01882876 |
| 4-nitrophenylpropan-1,2-dione |
| 1-(4'-Nitrophenyl)-propandion-(1,2) |
| 1-<(4-nitro)-phenyl>-1,2-propandione |