2,4-dihydroxy-6-(2-oxopropyl)benzoic acid structure
|
Common Name | 2,4-dihydroxy-6-(2-oxopropyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1206-69-5 | Molecular Weight | 210.18300 | |
| Density | 1.446g/cm3 | Boiling Point | 435.5ºC at 760mmHg | |
| Molecular Formula | C10H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.3ºC | |
| Name | 2,4-dihydroxy-6-(2-oxopropyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 435.5ºC at 760mmHg |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18300 |
| Flash Point | 231.3ºC |
| Exact Mass | 210.05300 |
| PSA | 94.83000 |
| LogP | 0.92750 |
| Vapour Pressure | 2.34E-08mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | SIXWWNJBOOYCOG-UHFFFAOYSA-N |
| SMILES | CC(=O)Cc1cc(O)cc(O)c1C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| dOPBA |
| 4,6-Dihydroxy-2-acetonyl-benzoesaeure |
| 2-carboxy-3,5-dihydroxybenzylmethyl ketone |
| 2,4-dihydroxy-6-acetonyl-benzoic acid |
| 2-Acetonyl-4,6-dihydroxy-benzoesaeure |
| 2-Carboxy-3,5-dihydroxybenzylmethylketon |
| 2-acetonyl-4,6-dihydroxy-benzoic acid |
| 2,4-Dihydroxi-6-acetonyl-benzoesaeure |