7,7,8,8,9,9,10,10,11,11,12,12,12-TRIDECAFLUORO-5-IODODODECANE structure
|
Common Name | 7,7,8,8,9,9,10,10,11,11,12,12,12-TRIDECAFLUORO-5-IODODODECANE | ||
|---|---|---|---|---|
| CAS Number | 120695-82-1 | Molecular Weight | 530.10700 | |
| Density | 1.672g/cm3 | Boiling Point | 265.3ºC at 760mmHg | |
| Molecular Formula | C12H12F13I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.8ºC | |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodododecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.672g/cm3 |
|---|---|
| Boiling Point | 265.3ºC at 760mmHg |
| Molecular Formula | C12H12F13I |
| Molecular Weight | 530.10700 |
| Flash Point | 120.8ºC |
| Exact Mass | 529.97800 |
| LogP | 7.10910 |
| Vapour Pressure | 0.0151mmHg at 25°C |
| Index of Refraction | 1.374 |
| InChIKey | BEQLOSVHRBTANS-UHFFFAOYSA-N |
| SMILES | CCCCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
|
~87%
7,7,8,8,9,9,10,... CAS#:120695-82-1 |
| Literature: Guo, Xiao-Chuan; Chen, Qing-Yun Journal of Fluorine Chemistry, 1998 , vol. 88, # 1 p. 63 - 70 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo-dodecane |
| Dodecane,1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodo |