LDV FITC structure
|
Common Name | LDV FITC | ||
|---|---|---|---|---|
| CAS Number | 1207610-07-8 | Molecular Weight | 1368.510 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C69H81N11O17S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LDV FITCLDV-FITC, a fluorescent peptide, is a FITC-conjugated LDV peptide (HY-P2267). LDV-FITC binds to the α4β1 integrin with high affinity (Kd: 0.3 nM and 12 nM for binding to U937 cells in the presence and absence of Mn2+ respectively). LDV-FITC can be used to detect α4β1 integrin affinity[1][2]. |
| Name | LDV FITC |
|---|---|
| Synonym | More Synonyms |
| Description | LDV-FITC, a fluorescent peptide, is a FITC-conjugated LDV peptide (HY-P2267). LDV-FITC binds to the α4β1 integrin with high affinity (Kd: 0.3 nM and 12 nM for binding to U937 cells in the presence and absence of Mn2+ respectively). LDV-FITC can be used to detect α4β1 integrin affinity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
α4β1 integrin[1] |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C69H81N11O17S |
| Molecular Weight | 1368.510 |
| Exact Mass | 1367.553223 |
| LogP | 6.55 |
| Index of Refraction | 1.676 |
| InChIKey | PAAUNHNWVWSJKI-CBRXRBRLSA-N |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(CC(=O)NC(CC(C)C)C(=O)NC(CC(=O)O)C(=O)NC(C(=O)N2CCCC2C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCCCNC(=S)Nc2ccc(C(=O)O)c(-c3c4ccc(=O)cc-4oc4cc(O)ccc34)c2)C(=O)O)C(C)C)cc1 |
| N-[(4-{[(2-Methylphenyl)carbamoyl]amino}phenyl)acetyl]-L-leucyl-L-α-aspartyl-L-valyl-L-prolyl-L-alanyl-L-alanyl-N6-{[4-carboxy-3-(6-hydroxy-3-oxo-3H-xanthen-9-yl)phenyl]carbamothioyl}-L-lysine |
| L-Lysine, N-[2-[4-[[[(2-methylphenyl)amino]carbonyl]amino]phenyl]acetyl]-L-leucyl-L-α-aspartyl-L-valyl-L-prolyl-L-alanyl-L-alanyl-N6-[[[4-carboxy-3-(6-hydroxy-3-oxo-3H-xanthen-9-yl)phenyl]amino] thioxomethyl]- |