5-[(4-hydroxy-3-methoxyphenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-[(4-hydroxy-3-methoxyphenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 120841-57-8 | Molecular Weight | 290.27100 | |
| Density | 1.393g/cm3 | Boiling Point | 444.5ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-hydroxy-3-methoxyphenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 444.5ºC at 760 mmHg |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27100 |
| Exact Mass | 290.09000 |
| PSA | 87.15000 |
| LogP | 0.71040 |
| Vapour Pressure | 1.63E-08mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | AQDOCIDKSFZRNF-UHFFFAOYSA-N |
| SMILES | COc1cc(C=C2C(=O)N(C)C(=O)N(C)C2=O)ccc1O |
|
~91%
5-[(4-hydroxy-3... CAS#:120841-57-8 |
| Literature: Rao, P. Shanthan; Venkataratnam, R. V. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1993 , vol. 32, # 4 p. 484 - 486 |
|
~0%
5-[(4-hydroxy-3... CAS#:120841-57-8 |
| Literature: Jalilzadeh, Mohammad; Pesyan, Nader Noroozi Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 9 p. 3382 - 3388 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-dimethyl-5-vanillylidene-barbituric acid |
| 1,3-Dimethyl-5-vanillyliden-barbitursaeure |