2-[(carboxymethyl)sulphonyl]benzoic acid structure
|
Common Name | 2-[(carboxymethyl)sulphonyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1209-81-0 | Molecular Weight | 244.22100 | |
| Density | 1.576g/cm3 | Boiling Point | 581.3ºC at 760mmHg | |
| Molecular Formula | C9H8O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.4ºC | |
| Name | 2-(carboxymethylsulfonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.576g/cm3 |
|---|---|
| Boiling Point | 581.3ºC at 760mmHg |
| Molecular Formula | C9H8O6S |
| Molecular Weight | 244.22100 |
| Flash Point | 305.4ºC |
| Exact Mass | 244.00400 |
| PSA | 117.12000 |
| LogP | 1.32390 |
| Vapour Pressure | 2.35E-14mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | STPWPICGADJXAM-UHFFFAOYSA-N |
| SMILES | O=C(O)CS(=O)(=O)c1ccccc1C(=O)O |
| HS Code | 2917399090 |
|---|
|
~%
2-[(carboxymeth... CAS#:1209-81-0 |
| Literature: Arndt; Kirsch; Nachtwey Chemische Berichte, 1926 , vol. 59, p. 1078 Full Text Show Details Feist Chemische Berichte, 1925 , vol. 58, p. 2312,2313, 2317 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-carboxymethanesulfonyl-benzoic acid |
| Phenylsulfonessigsaeure-o-carbonsaeure |
| 2-Carboxymethylsulfon-benzoesaeure |
| 2-[(carboxymethyl)sulphonyl]benzoic acid |
| 2-(carboxymethyl-sulfonyl)-benzoic acid |
| 2-Carboxymethansulfonyl-benzoesaeure |