5-Chloro-2-(4-chlorophenoxy)aniline structure
|
Common Name | 5-Chloro-2-(4-chlorophenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 121-27-7 | Molecular Weight | 254.112 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 354.0±32.0 °C at 760 mmHg | |
| Molecular Formula | C12H9Cl2NO | Melting Point | 51-53 °C(lit.) | |
| MSDS | N/A | Flash Point | 167.9±25.1 °C | |
| Name | 5-Chloro-2-(4-chlorophenoxy)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.0±32.0 °C at 760 mmHg |
| Melting Point | 51-53 °C(lit.) |
| Molecular Formula | C12H9Cl2NO |
| Molecular Weight | 254.112 |
| Flash Point | 167.9±25.1 °C |
| Exact Mass | 253.006119 |
| PSA | 35.25000 |
| LogP | 3.94 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | WLJSUJOESWTGEX-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)ccc1Oc1ccc(Cl)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922299090 |
|
~%
5-Chloro-2-(4-c... CAS#:121-27-7 |
| Literature: Journal of the Chemical Society, , p. 521 |
|
~%
5-Chloro-2-(4-c... CAS#:121-27-7 |
| Literature: Journal of the Chemical Society, , p. 521 |
|
~%
5-Chloro-2-(4-c... CAS#:121-27-7 |
| Literature: Journal of the Chemical Society, , p. 521 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Chloro-2-(p-chlorophenoxy)aniline |
| Benzenamine, 5-chloro-2- (4-chlorophenoxy)- |
| 5-Chloro-2-(4-chloro-phenoxy)-phenylamine |
| MFCD00027391 |
| 2-AMINO-4,4'-DICHLORODIPHENYL ETHER |
| EINECS 204-460-5 |
| Benzenamine, 5-chloro-2-(4-chlorophenoxy)- |
| 5-Chloro-2-(4-chlorophenoxy)aniline |
| Aniline, 5-chloro-2- (p-chlorophenoxy)- |