9H-Purin-6-amine,N-phenyl- structure
|
Common Name | 9H-Purin-6-amine,N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1210-66-8 | Molecular Weight | 211.22300 | |
| Density | 1.431g/cm3 | Boiling Point | 541.2ºC at 760mmHg | |
| Molecular Formula | C11H9N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.1ºC | |
| Name | N-phenyl-7H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 541.2ºC at 760mmHg |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.22300 |
| Flash Point | 281.1ºC |
| Exact Mass | 211.08600 |
| PSA | 66.49000 |
| LogP | 2.16950 |
| Vapour Pressure | 2.74E-05mmHg at 25°C |
| Index of Refraction | 1.761 |
| InChIKey | WCZNSRQVTJYMRQ-UHFFFAOYSA-N |
| SMILES | c1ccc(Nc2ncnc3nc[nH]c23)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| HS Code | 2933990090 |
|
~86%
9H-Purin-6-amin... CAS#:1210-66-8 |
| Literature: Huang, Ling-Kuen; Cherng, Yen-Chih; Cheng, Yann-Ru; Jang, Jing-Pei; Chao, Yi-Ling; Cherng, Yie-Jia Tetrahedron, 2007 , vol. 63, # 24 p. 5323 - 5327 |
|
~80%
9H-Purin-6-amin... CAS#:1210-66-8 |
| Literature: Girgis; Pedersen Synthesis, 1982 , vol. No. 6, p. 480 - 482 |
|
~74%
9H-Purin-6-amin... CAS#:1210-66-8 |
| Literature: Villar, Jose Daniel Figueroa; Motta, Marita Almeida Nucleosides, Nucleotides and Nucleic Acids, 2000 , vol. 19, # 5-6 p. 1005 - 1015 |
|
~%
9H-Purin-6-amin... CAS#:1210-66-8 |
| Literature: Nucleosides, Nucleotides and Nucleic Acids, , vol. 19, # 5-6 p. 1005 - 1015 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N6-Phenylaminopurine |
| 6-Anilinopurine |
| N-phenyl-9H-purin-6-amine |
| 6-Phenylaminopurine |
| Adenine,N-phenyl |
| phenyl-(7(9)H-purin-6-yl)-amine |
| N-Purin-6-ylaniline |
| 1H-Purin-6-amine,N-phenyl |
| 6-Anilino-9H-purine |
| N6-phenyladenine |
| PHENYL(9H-PURIN-6-YL)AMINE |
| N-Phenyladenine |