Erlotinib-13C6 hydrochloride structure
|
Common Name | Erlotinib-13C6 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1210610-07-3 | Molecular Weight | 435.85300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Erlotinib-13C6 hydrochlorideErlotinib-13C6 (hydrochloride) is the 13C labeled Erlotinib Hydrochloride[1]. Erlotinib Hydrochloride (CP-358774 Hydrochloride) inhibits purified EGFR kinase with an IC50 of 2 nM[2]. |
| Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine,hydrochloride |
|---|
| Description | Erlotinib-13C6 (hydrochloride) is the 13C labeled Erlotinib Hydrochloride[1]. Erlotinib Hydrochloride (CP-358774 Hydrochloride) inhibits purified EGFR kinase with an IC50 of 2 nM[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C22H24ClN3O4 |
|---|---|
| Molecular Weight | 435.85300 |
| Exact Mass | 435.16600 |
| PSA | 74.73000 |
| LogP | 4.28010 |
| InChIKey | GTTBEUCJPZQMDZ-WQQMTWEQSA-N |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1.Cl |