L-Histidine-13C6 hydrochloride hydrate structure
|
Common Name | L-Histidine-13C6 hydrochloride hydrate | ||
|---|---|---|---|---|
| CAS Number | 201740-88-7 | Molecular Weight | 215.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | 13C6H12ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Histidine-13C6 hydrochloride hydrateL-Histidine-13C6 (H-His-OH-13C6) hydrochloride hydrate is the 13C-labeled L-Histidine hydrochloride hydrate. L-Histidine hydrochloride hydrate (H-His-OH.HCl.H2O) is an endogenous metabolite. |
| Name | L-Histidine-13C6 hydrochloride hydrate |
|---|
| Description | L-Histidine-13C6 (H-His-OH-13C6) hydrochloride hydrate is the 13C-labeled L-Histidine hydrochloride hydrate. L-Histidine hydrochloride hydrate (H-His-OH.HCl.H2O) is an endogenous metabolite. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | 13C6H12ClN3O3 |
|---|---|
| Molecular Weight | 215.59 |
| InChIKey | CMXXUDSWGMGYLZ-NHMLGGAVSA-N |
| SMILES | Cl.NC(Cc1cnc[nH]1)C(=O)O.O |