Phenyl phenylthio sulfone structure
|
Common Name | Phenyl phenylthio sulfone | ||
|---|---|---|---|---|
| CAS Number | 1212-08-4 | Molecular Weight | 250.337 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 408.2±28.0 °C at 760 mmHg | |
| Molecular Formula | C12H10O2S2 | Melting Point | 36-53ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 200.7±24.0 °C | |
| Name | benzenesulfonylsulfanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.2±28.0 °C at 760 mmHg |
| Melting Point | 36-53ºC(lit.) |
| Molecular Formula | C12H10O2S2 |
| Molecular Weight | 250.337 |
| Flash Point | 200.7±24.0 °C |
| Exact Mass | 250.012222 |
| PSA | 67.82000 |
| LogP | 3.76 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | ATKJLMWDXASAJA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Sc1ccccc1)c1ccccc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2930909090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 214-919-1 |
| Phenyl benzenethiosulfonate |
| S-Phenyl benzenethiosulfonate |
| S-Phenyl benzenesulfonothioate |
| Phenyl phenylthio sulfone |
| MFCD00014738 |
| Phenyl disulfoxide |
| Benzenethiosulfonic acid S-phenyl ester |
| Benzenesulfonothioic acid, S-phenyl ester |
| Benzenesulfonothioic acid,S-phenyl ester |