(S)-TXNIP-IN-1 structure
|
Common Name | (S)-TXNIP-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1212421-96-9 | Molecular Weight | 248.235 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 443.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.0±23.2 °C | |
Use of (S)-TXNIP-IN-1(S)-TXNIP-IN-1 is the S-enantiomer of TXNIP-IN-1 (HY-115688). TXNIP-IN-1 is a TXNIP-TRX complex inhibitor which can be used in the research of TXNIP-TRX complex associated metabolic disorder (diabetes), cardiovascular disease, or inflammatory disease[1] |
| Name | (2S)-2-(1,3-Dioxo-1,3-dihydro-2H-pyrrolo[3,4-c]pyridin-2-yl)-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-TXNIP-IN-1 is the S-enantiomer of TXNIP-IN-1 (HY-115688). TXNIP-IN-1 is a TXNIP-TRX complex inhibitor which can be used in the research of TXNIP-TRX complex associated metabolic disorder (diabetes), cardiovascular disease, or inflammatory disease[1] |
|---|---|
| Related Catalog | |
| References |
[1]. Rama Natarajan, et al. Txnip-trx complex inhibitors and methods of using the same. US20200085800A1. |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 443.5±25.0 °C at 760 mmHg |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.235 |
| Flash Point | 222.0±23.2 °C |
| Exact Mass | 248.079712 |
| LogP | 0.93 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | KTDYLXVLROCGRL-VIFPVBQESA-N |
| SMILES | CC(C)C(C(=O)O)N1C(=O)c2ccncc2C1=O |
| (2S)-2-(1,3-Dioxo-1,3-dihydro-2H-pyrrolo[3,4-c]pyridin-2-yl)-3-methylbutanoic acid |
| 2H-Pyrrolo[3,4-c]pyridine-2-acetic acid, 1,3-dihydro-α-(1-methylethyl)-1,3-dioxo-, (αS)- |
| MFCD11108870 |