(E)-3-(2-chloro-4,5-difluorophenyl)-1-phenylbut-2-en-1-one structure
|
Common Name | (E)-3-(2-chloro-4,5-difluorophenyl)-1-phenylbut-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 1212761-18-6 | Molecular Weight | 292.70800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11ClF2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-3-(2-chloro-4,5-difluorophenyl)-1-phenylbut-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11ClF2O |
|---|---|
| Molecular Weight | 292.70800 |
| Exact Mass | 292.04700 |
| PSA | 17.07000 |
| LogP | 4.90440 |
| InChIKey | MOXFYXLULXMQCZ-JXMROGBWSA-N |
| SMILES | CC(=CC(=O)c1ccccc1)c1cc(F)c(F)cc1Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-(2-Chloro-4,5-difluorophenyl)-1-phenylbut-2-en-1-one |