rac-1-(N-tert-Butoxycarbonylamino)-2-hydroxy-3-phenoxypropane structure
|
Common Name | rac-1-(N-tert-Butoxycarbonylamino)-2-hydroxy-3-phenoxypropane | ||
|---|---|---|---|---|
| CAS Number | 121282-71-1 | Molecular Weight | 267.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | rac-1-(N-tert-Butoxycarbonylamino)-2-hydroxy-3-phenoxypropane |
|---|
| Molecular Formula | C14H21NO4 |
|---|---|
| Molecular Weight | 267.32100 |
| Exact Mass | 267.14700 |
| PSA | 67.79000 |
| LogP | 2.34190 |
| InChIKey | KKYSYZXSOCQCJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(O)COc1ccccc1 |
|
~94%
rac-1-(N-tert-B... CAS#:121282-71-1 |
| Literature: Kawamoto; Wills Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 16 p. 1916 - 1928 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |